H6Cl6Si6 — CID 154085707
1,2,3,4,5,6-hexachlorohexasilinane (PubChem CID 154085707) has the molecular formula H6Cl6Si6 and a molecular weight of 387.28 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexachlorohexasilinane.
| Compound Name | 1,2,3,4,5,6-hexachlorohexasilinane |
|---|---|
| PubChem CID | 154085707 |
| Molecular Formula | H6Cl6Si6 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 383.72 |
| IUPAC Name | 1,2,3,4,5,6-hexachlorohexasilinane |
| SMILES | Cl[SiH]1[SiH](Cl)[SiH](Cl)[SiH](Cl)[SiH](Cl)[SiH]1Cl |
| InChI | InChI=1S/Cl6H6Si6/c1-7-8(2)10(4)12(6)11(5)9(7)3/h7-12H |
| InChIKey | ZUJOACIBNBMMDN-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|