C21H32O2 — CID 154085855
(8S,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-1-one (PubChem CID 154085855) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-1-one.
| Compound Name | (8S,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-1-one |
|---|---|
| PubChem CID | 154085855 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (8S,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-1-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC(=O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H32O2/c1-13(22)16-9-10-17-15-8-7-14-5-4-6-19(23)21(14,3)18(15)11-12-20(16,17)2/h14-18H,4-12H2,1-3H3/t14?,15-,16+,17-,18-,20+,21-/m0/s1 |
| InChIKey | RZVGPBCXHKZITI-RCCFCTDXSA-N |
| XLogP | 4.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |