About 6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile
6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile (PubChem CID 154086393) has the molecular formula C14H10N4
and a molecular weight of 234.26 g/mol. Its IUPAC name is 6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile.
Molecular Properties
| Compound Name | 6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile |
| PubChem CID | 154086393 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)C=CC=CC1/N=N/c1ccccc1 |
| InChI | InChI=1S/C14H10N4/c15-10-14(11-16)9-5-4-8-13(14)18-17-12-6-2-1-3-7-12/h1-9,13H/b18-17+ |
| InChIKey | LMXCDWXUQJAAIR-ISLYRVAYSA-N |
| XLogP | 3.30 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile?
The IUPAC name of 6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile (CID 154086393) is 6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile.
What is the SMILES notation for 6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile?
The canonical SMILES for 6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile is N#CC1(C#N)C=CC=CC1/N=N/c1ccccc1.
What is the InChIKey of 6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile?
The InChIKey is LMXCDWXUQJAAIR-ISLYRVAYSA-N. The full InChI is InChI=1S/C14H10N4/c15-10-14(11-16)9-5-4-8-13(14)18-17-12-6-2-1-3-7-12/h1-9,13H/b18-17+.
What are the key properties of 6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile?
6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile has a molecular weight of 234.26 g/mol, XLogP of 3.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarbonitrile is sourced from PubChem (CID 154086393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).