C12H10O4 — CID 154088408
(2,3-dihydroxynaphthalen-1-yl) acetate (PubChem CID 154088408) has the molecular formula C12H10O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is (2,3-dihydroxynaphthalen-1-yl) acetate.
| Compound Name | (2,3-dihydroxynaphthalen-1-yl) acetate |
|---|---|
| PubChem CID | 154088408 |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | (2,3-dihydroxynaphthalen-1-yl) acetate |
| SMILES | CC(=O)Oc1c(O)c(O)cc2ccccc12 |
| InChI | InChI=1S/C12H10O4/c1-7(13)16-12-9-5-3-2-4-8(9)6-10(14)11(12)15/h2-6,14-15H,1H3 |
| InChIKey | MAXFADDCSLCQFP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|