C9H6Cl6O2S — CID 154088531
1,2,3,4,7,7-hexachloro-5-ethenylsulfonylbicyclo[2.2.1]hept-2-ene (PubChem CID 154088531) has the molecular formula C9H6Cl6O2S and a molecular weight of 390.93 g/mol. Its IUPAC name is 1,2,3,4,7,7-hexachloro-5-ethenylsulfonylbicyclo[2.2.1]hept-2-ene.
| Compound Name | 1,2,3,4,7,7-hexachloro-5-ethenylsulfonylbicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 154088531 |
| Molecular Formula | C9H6Cl6O2S |
| Molecular Weight | 390.93 g/mol |
| Exact Mass | 387.82 |
| IUPAC Name | 1,2,3,4,7,7-hexachloro-5-ethenylsulfonylbicyclo[2.2.1]hept-2-ene |
| SMILES | C=CS(=O)(=O)C1CC2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C9H6Cl6O2S/c1-2-18(16,17)4-3-7(12)5(10)6(11)8(4,13)9(7,14)15/h2,4H,1,3H2 |
| InChIKey | BFOHQJRYVWUZTO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.93 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|