C20H32O2 — CID 15409095
(2S,3R,3aS)-3,3a,4,4-tetramethyl-3-(4-methylpent-3-enyl)-1,2,5,6-tetrahydroindene-2-carboxylic acid (PubChem CID 15409095) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (2S,3R,3aS)-3,3a,4,4-tetramethyl-3-(4-methylpent-3-enyl)-1,2,5,6-tetrahydroindene-2-carboxylic acid.
| Compound Name | (2S,3R,3aS)-3,3a,4,4-tetramethyl-3-(4-methylpent-3-enyl)-1,2,5,6-tetrahydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 15409095 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (2S,3R,3aS)-3,3a,4,4-tetramethyl-3-(4-methylpent-3-enyl)-1,2,5,6-tetrahydroindene-2-carboxylic acid |
| SMILES | CC(C)=CCC[C@]1(C)[C@@H](C(=O)O)CC2=CCCC(C)(C)[C@@]21C |
| InChI | InChI=1S/C20H32O2/c1-14(2)9-7-12-19(5)16(17(21)22)13-15-10-8-11-18(3,4)20(15,19)6/h9-10,16H,7-8,11-13H2,1-6H3,(H,21,22)/t16-,19-,20-/m1/s1 |
| InChIKey | AGTOVGMLTLDCNN-NSISKUIASA-N |
| XLogP | 5.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|