C20H34O — CID 15409096
[(2S,3R,3aS)-3,3a,4,4-tetramethyl-3-(4-methylpent-3-enyl)-1,2,5,6-tetrahydroinden-2-yl]methanol (PubChem CID 15409096) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is [(2S,3R,3aS)-3,3a,4,4-tetramethyl-3-(4-methylpent-3-enyl)-1,2,5,6-tetrahydroinden-2-yl]methanol.
| Compound Name | [(2S,3R,3aS)-3,3a,4,4-tetramethyl-3-(4-methylpent-3-enyl)-1,2,5,6-tetrahydroinden-2-yl]methanol |
|---|---|
| PubChem CID | 15409096 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | [(2S,3R,3aS)-3,3a,4,4-tetramethyl-3-(4-methylpent-3-enyl)-1,2,5,6-tetrahydroinden-2-yl]methanol |
| SMILES | CC(C)=CCC[C@]1(C)[C@@H](CO)CC2=CCCC(C)(C)[C@@]21C |
| InChI | InChI=1S/C20H34O/c1-15(2)9-7-12-19(5)17(14-21)13-16-10-8-11-18(3,4)20(16,19)6/h9-10,17,21H,7-8,11-14H2,1-6H3/t17-,19-,20-/m1/s1 |
| InChIKey | ZOEKHZKDHHUENY-MISYRCLQSA-N |
| XLogP | 5.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|