C15H28O5Si — CID 15409116
(3R,4R,5R)-5-hydroxy-3,4,5-trimethyl-2-methylidene-6-oxo-6-(2-trimethylsilylethoxy)hexanoic acid (PubChem CID 15409116) has the molecular formula C15H28O5Si and a molecular weight of 316.47 g/mol. Its IUPAC name is (3R,4R,5R)-5-hydroxy-3,4,5-trimethyl-2-methylidene-6-oxo-6-(2-trimethylsilylethoxy)hexanoic acid.
| Compound Name | (3R,4R,5R)-5-hydroxy-3,4,5-trimethyl-2-methylidene-6-oxo-6-(2-trimethylsilylethoxy)hexanoic acid |
|---|---|
| PubChem CID | 15409116 |
| Molecular Formula | C15H28O5Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (3R,4R,5R)-5-hydroxy-3,4,5-trimethyl-2-methylidene-6-oxo-6-(2-trimethylsilylethoxy)hexanoic acid |
| SMILES | C=C(C(=O)O)[C@H](C)[C@@H](C)[C@@](C)(O)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C15H28O5Si/c1-10(11(2)13(16)17)12(3)15(4,19)14(18)20-8-9-21(5,6)7/h10,12,19H,2,8-9H2,1,3-7H3,(H,16,17)/t10-,12+,15+/m0/s1 |
| InChIKey | RCQGDSZBOGIAPE-JVLSTEMRSA-N |
| XLogP | 2.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|