C21H19NO6 — CID 154091225
N-(4,7-dihydroxy-2-oxochromen-3-yl)-2,2-dimethyl-3,4-dihydrochromene-6-carboxamide (PubChem CID 154091225) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is N-(4,7-dihydroxy-2-oxochromen-3-yl)-2,2-dimethyl-3,4-dihydrochromene-6-carboxamide.
| Compound Name | N-(4,7-dihydroxy-2-oxochromen-3-yl)-2,2-dimethyl-3,4-dihydrochromene-6-carboxamide |
|---|---|
| PubChem CID | 154091225 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-(4,7-dihydroxy-2-oxochromen-3-yl)-2,2-dimethyl-3,4-dihydrochromene-6-carboxamide |
| SMILES | CC1(C)CCc2cc(C(=O)Nc3c(O)c4ccc(O)cc4oc3=O)ccc2O1 |
| InChI | InChI=1S/C21H19NO6/c1-21(2)8-7-11-9-12(3-6-15(11)28-21)19(25)22-17-18(24)14-5-4-13(23)10-16(14)27-20(17)26/h3-6,9-10,23-24H,7-8H2,1-2H3,(H,22,25) |
| InChIKey | QFXACCLCGONXAK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|