About [(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate
[(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate (PubChem CID 15409131) has the molecular formula C19H24N4O3
and a molecular weight of 356.43 g/mol. Its IUPAC name is [(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate.
Molecular Properties
| Compound Name | [(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate |
| PubChem CID | 15409131 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate |
| SMILES | CC(=O)O[C@H]1CCC[C@H]1Oc1nc(N2CCNCC2)nc2ccccc12 |
| InChI | InChI=1S/C19H24N4O3/c1-13(24)25-16-7-4-8-17(16)26-18-14-5-2-3-6-15(14)21-19(22-18)23-11-9-20-10-12-23/h2-3,5-6,16-17,20H,4,7-12H2,1H3/t16-,17+/m0/s1 |
| InChIKey | YTQPQHJQISJVSR-DLBZAZTESA-N |
| XLogP | 1.90 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate?
The IUPAC name of [(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate (CID 15409131) is [(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate.
What is the SMILES notation for [(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate?
The canonical SMILES for [(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate is CC(=O)O[C@H]1CCC[C@H]1Oc1nc(N2CCNCC2)nc2ccccc12.
What is the InChIKey of [(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate?
The InChIKey is YTQPQHJQISJVSR-DLBZAZTESA-N. The full InChI is InChI=1S/C19H24N4O3/c1-13(24)25-16-7-4-8-17(16)26-18-14-5-2-3-6-15(14)21-19(22-18)23-11-9-20-10-12-23/h2-3,5-6,16-17,20H,4,7-12H2,1H3/t16-,17+/m0/s1.
What are the key properties of [(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate?
[(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate has a molecular weight of 356.43 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentyl] acetate is sourced from PubChem (CID 15409131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).