C15H28N2 — CID 154091731
N,1-dibutyl-3,3,5-trimethylpyrrol-2-imine (PubChem CID 154091731) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is N,1-dibutyl-3,3,5-trimethylpyrrol-2-imine.
| Compound Name | N,1-dibutyl-3,3,5-trimethylpyrrol-2-imine |
|---|---|
| PubChem CID | 154091731 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | N,1-dibutyl-3,3,5-trimethylpyrrol-2-imine |
| SMILES | CCCC/N=C1\N(CCCC)C(C)=CC1(C)C |
| InChI | InChI=1S/C15H28N2/c1-6-8-10-16-14-15(4,5)12-13(3)17(14)11-9-7-2/h12H,6-11H2,1-5H3/b16-14- |
| InChIKey | VPNUXQVCTZYGBR-PEZBUJJGSA-N |
| XLogP | 4.23 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|