C3Br2Cl4O — CID 154093040
1,3-dibromo-1,1,3,3-tetrachloropropan-2-one (PubChem CID 154093040) has the molecular formula C3Br2Cl4O and a molecular weight of 353.65 g/mol. Its IUPAC name is 1,3-dibromo-1,1,3,3-tetrachloropropan-2-one.
| Compound Name | 1,3-dibromo-1,1,3,3-tetrachloropropan-2-one |
|---|---|
| PubChem CID | 154093040 |
| Molecular Formula | C3Br2Cl4O |
| Molecular Weight | 353.65 g/mol |
| Exact Mass | 349.71 |
| IUPAC Name | 1,3-dibromo-1,1,3,3-tetrachloropropan-2-one |
| SMILES | O=C(C(Cl)(Cl)Br)C(Cl)(Cl)Br |
| InChI | InChI=1S/C3Br2Cl4O/c4-2(6,7)1(10)3(5,8)9 |
| InChIKey | KBVWPELMUHDUFI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.65 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|