C29H43N9O8 — CID 15409414
2-[(2S,5R,8S,14S)-5-benzyl-14-[3-(diaminomethylideneamino)propyl]-8-(2-methylpropyl)-3,6,9,12,15,18-hexaoxo-1,4,7,10,13,16-hexazacyclooctadec-2-yl]acetic acid (PubChem CID 15409414) has the molecular formula C29H43N9O8 and a molecular weight of 645.72 g/mol. Its IUPAC name is 2-[(2S,5R,8S,14S)-5-benzyl-14-[3-(diaminomethylideneamino)propyl]-8-(2-methylpropyl)-3,6,9,12,15,18-hexaoxo-1,4,7,10,13,16-hexazacyclooctadec-2-yl]acetic acid.
| Compound Name | 2-[(2S,5R,8S,14S)-5-benzyl-14-[3-(diaminomethylideneamino)propyl]-8-(2-methylpropyl)-3,6,9,12,15,18-hexaoxo-1,4,7,10,13,16-hexazacyclooctadec-2-yl]acetic acid |
|---|---|
| PubChem CID | 15409414 |
| Molecular Formula | C29H43N9O8 |
| Molecular Weight | 645.72 g/mol |
| Exact Mass | 645.32 |
| IUPAC Name | 2-[(2S,5R,8S,14S)-5-benzyl-14-[3-(diaminomethylideneamino)propyl]-8-(2-methylpropyl)-3,6,9,12,15,18-hexaoxo-1,4,7,10,13,16-hexazacyclooctadec-2-yl]acetic acid |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)CNC1=O |
| InChI | InChI=1S/C29H43N9O8/c1-16(2)11-19-26(44)34-14-22(39)35-18(9-6-10-32-29(30)31)25(43)33-15-23(40)36-21(13-24(41)42)28(46)38-20(27(45)37-19)12-17-7-4-3-5-8-17/h3-5,7-8,16,18-21H,6,9-15H2,1-2H3,(H,33,43)(H,34,44)(H,35,39)(H,36,40)(H,37,45)(H,38,46)(H,41,42)(H4,30,31,32)/t18-,19-,20+,21-/m0/s1 |
| InChIKey | VRTNUMBPIBDYLD-BURNTYAHSA-N |
| XLogP | -3.01 |
| TPSA | 276.30 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.72 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|