About 2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol
2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol (PubChem CID 15409472) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol |
| PubChem CID | 15409472 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol |
| SMILES | COC(CO)C1(C)CCCC(C)(C)O1 |
| InChI | InChI=1S/C11H22O3/c1-10(2)6-5-7-11(3,14-10)9(8-12)13-4/h9,12H,5-8H2,1-4H3 |
| InChIKey | HSELUQOVPZRCJE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol?
The IUPAC name of 2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol (CID 15409472) is 2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol.
What is the SMILES notation for 2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol?
The canonical SMILES for 2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol is COC(CO)C1(C)CCCC(C)(C)O1.
What is the InChIKey of 2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol?
The InChIKey is HSELUQOVPZRCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-10(2)6-5-7-11(3,14-10)9(8-12)13-4/h9,12H,5-8H2,1-4H3.
What are the key properties of 2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol?
2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol has a molecular weight of 202.29 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2-(2,6,6-trimethyloxan-2-yl)ethanol is sourced from PubChem (CID 15409472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).