C33H36ClOP — CID 15409485
(1R)-4-[(E)-5-[chloro(triphenyl)-lambda5-phosphanyl]-3-methylpent-3-en-1-ynyl]-3,5,5-trimethylcyclohex-3-en-1-ol (PubChem CID 15409485) has the molecular formula C33H36ClOP and a molecular weight of 515.08 g/mol. Its IUPAC name is (1R)-4-[(E)-5-[chloro(triphenyl)-lambda5-phosphanyl]-3-methylpent-3-en-1-ynyl]-3,5,5-trimethylcyclohex-3-en-1-ol.
| Compound Name | (1R)-4-[(E)-5-[chloro(triphenyl)-lambda5-phosphanyl]-3-methylpent-3-en-1-ynyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 15409485 |
| Molecular Formula | C33H36ClOP |
| Molecular Weight | 515.08 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | (1R)-4-[(E)-5-[chloro(triphenyl)-lambda5-phosphanyl]-3-methylpent-3-en-1-ynyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
| SMILES | CC1=C(C#C/C(C)=C/CP(Cl)(c2ccccc2)(c2ccccc2)c2ccccc2)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C33H36ClOP/c1-26(20-21-32-27(2)24-28(35)25-33(32,3)4)22-23-36(34,29-14-8-5-9-15-29,30-16-10-6-11-17-30)31-18-12-7-13-19-31/h5-19,22,28,35H,23-25H2,1-4H3/b26-22+/t28-/m1/s1 |
| InChIKey | SJFONRUFGJIPKL-XTDSMPNESA-N |
| XLogP | 7.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.08 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|