C20H28O4 — CID 15409588
(3aS,3bS,5aS,9aS,11aS)-11a-hydroxy-3b,6,6,9a-tetramethyl-1,3a,4,5,5a,7,8,9-octahydronaphtho[1,2-g][2]benzofuran-3,11-dione (PubChem CID 15409588) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (3aS,3bS,5aS,9aS,11aS)-11a-hydroxy-3b,6,6,9a-tetramethyl-1,3a,4,5,5a,7,8,9-octahydronaphtho[1,2-g][2]benzofuran-3,11-dione.
| Compound Name | (3aS,3bS,5aS,9aS,11aS)-11a-hydroxy-3b,6,6,9a-tetramethyl-1,3a,4,5,5a,7,8,9-octahydronaphtho[1,2-g][2]benzofuran-3,11-dione |
|---|---|
| PubChem CID | 15409588 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (3aS,3bS,5aS,9aS,11aS)-11a-hydroxy-3b,6,6,9a-tetramethyl-1,3a,4,5,5a,7,8,9-octahydronaphtho[1,2-g][2]benzofuran-3,11-dione |
| SMILES | CC1(C)CCC[C@]2(C)C3=CC(=O)[C@@]4(O)COC(=O)[C@H]4[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C20H28O4/c1-17(2)7-5-8-18(3)12(17)6-9-19(4)13(18)10-14(21)20(23)11-24-16(22)15(19)20/h10,12,15,23H,5-9,11H2,1-4H3/t12-,15-,18-,19+,20-/m0/s1 |
| InChIKey | NWOGMJDXYMXDEI-RBZAMRJTSA-N |
| XLogP | 3.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |