About 2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine
2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine (PubChem CID 154095966) has the molecular formula C10H21N5
and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine.
Molecular Properties
| Compound Name | 2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine |
| PubChem CID | 154095966 |
| Molecular Formula | C10H21N5 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.18 |
| IUPAC Name | 2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine |
| SMILES | CNC1(CCCN(C)C)N=CC(N)=CN1 |
| InChI | InChI=1S/C10H21N5/c1-12-10(5-4-6-15(2)3)13-7-9(11)8-14-10/h7-8,12-13H,4-6,11H2,1-3H3 |
| InChIKey | WLFZYJPEEOZQQU-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine?
The IUPAC name of 2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine (CID 154095966) is 2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine.
What is the SMILES notation for 2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine?
The canonical SMILES for 2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine is CNC1(CCCN(C)C)N=CC(N)=CN1.
What is the InChIKey of 2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine?
The InChIKey is WLFZYJPEEOZQQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N5/c1-12-10(5-4-6-15(2)3)13-7-9(11)8-14-10/h7-8,12-13H,4-6,11H2,1-3H3.
What are the key properties of 2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine?
2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine has a molecular weight of 211.31 g/mol, XLogP of -0.32, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(dimethylamino)propyl]-2-N-methyl-1H-pyrimidine-2,5-diamine is sourced from PubChem (CID 154095966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).