About 4-hept-3-en-4-ylphenol
4-hept-3-en-4-ylphenol (PubChem CID 154096280) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-hept-3-en-4-ylphenol.
Molecular Properties
| Compound Name | 4-hept-3-en-4-ylphenol |
| PubChem CID | 154096280 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 4-hept-3-en-4-ylphenol |
| SMILES | CCC=C(CCC)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H18O/c1-3-5-11(6-4-2)12-7-9-13(14)10-8-12/h5,7-10,14H,3-4,6H2,1-2H3 |
| InChIKey | PGRGNGAGXYYIOK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-hept-3-en-4-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hept-3-en-4-ylphenol?
The IUPAC name of 4-hept-3-en-4-ylphenol (CID 154096280) is 4-hept-3-en-4-ylphenol.
What is the SMILES notation for 4-hept-3-en-4-ylphenol?
The canonical SMILES for 4-hept-3-en-4-ylphenol is CCC=C(CCC)c1ccc(O)cc1.
What is the InChIKey of 4-hept-3-en-4-ylphenol?
The InChIKey is PGRGNGAGXYYIOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-3-5-11(6-4-2)12-7-9-13(14)10-8-12/h5,7-10,14H,3-4,6H2,1-2H3.
What are the key properties of 4-hept-3-en-4-ylphenol?
4-hept-3-en-4-ylphenol has a molecular weight of 190.29 g/mol, XLogP of 3.99, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hept-3-en-4-ylphenol is sourced from PubChem (CID 154096280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).