C8H8F6S — CID 154096347
1,1,2-trifluoro-4-(3,4,4-trifluorobut-3-enylsulfanyl)but-1-ene (PubChem CID 154096347) has the molecular formula C8H8F6S and a molecular weight of 250.21 g/mol. Its IUPAC name is 1,1,2-trifluoro-4-(3,4,4-trifluorobut-3-enylsulfanyl)but-1-ene.
| Compound Name | 1,1,2-trifluoro-4-(3,4,4-trifluorobut-3-enylsulfanyl)but-1-ene |
|---|---|
| PubChem CID | 154096347 |
| Molecular Formula | C8H8F6S |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 1,1,2-trifluoro-4-(3,4,4-trifluorobut-3-enylsulfanyl)but-1-ene |
| SMILES | FC(F)=C(F)CCSCCC(F)=C(F)F |
| InChI | InChI=1S/C8H8F6S/c9-5(7(11)12)1-3-15-4-2-6(10)8(13)14/h1-4H2 |
| InChIKey | SDDXMAXJAAWZTF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|