C14H16O2 — CID 15409695
3-but-3-enyl-3,6-dimethyl-1-benzofuran-2-one (PubChem CID 15409695) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-but-3-enyl-3,6-dimethyl-1-benzofuran-2-one.
| Compound Name | 3-but-3-enyl-3,6-dimethyl-1-benzofuran-2-one |
|---|---|
| PubChem CID | 15409695 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 3-but-3-enyl-3,6-dimethyl-1-benzofuran-2-one |
| SMILES | C=CCCC1(C)C(=O)Oc2cc(C)ccc21 |
| InChI | InChI=1S/C14H16O2/c1-4-5-8-14(3)11-7-6-10(2)9-12(11)16-13(14)15/h4,6-7,9H,1,5,8H2,2-3H3 |
| InChIKey | ZKHSDCQQRXIFGA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|