About trimethyl oct-7-enyl silicate
trimethyl oct-7-enyl silicate (PubChem CID 154097389) has the molecular formula C11H24O4Si
and a molecular weight of 248.39 g/mol. Its IUPAC name is trimethyl oct-7-enyl silicate.
Molecular Properties
| Compound Name | trimethyl oct-7-enyl silicate |
| PubChem CID | 154097389 |
| Molecular Formula | C11H24O4Si |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | trimethyl oct-7-enyl silicate |
| SMILES | C=CCCCCCCO[Si](OC)(OC)OC |
| InChI | InChI=1S/C11H24O4Si/c1-5-6-7-8-9-10-11-15-16(12-2,13-3)14-4/h5H,1,6-11H2,2-4H3 |
| InChIKey | VHPULYDBSGFGCY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl oct-7-enyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl oct-7-enyl silicate?
The IUPAC name of trimethyl oct-7-enyl silicate (CID 154097389) is trimethyl oct-7-enyl silicate.
What is the SMILES notation for trimethyl oct-7-enyl silicate?
The canonical SMILES for trimethyl oct-7-enyl silicate is C=CCCCCCCO[Si](OC)(OC)OC.
What is the InChIKey of trimethyl oct-7-enyl silicate?
The InChIKey is VHPULYDBSGFGCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O4Si/c1-5-6-7-8-9-10-11-15-16(12-2,13-3)14-4/h5H,1,6-11H2,2-4H3.
What are the key properties of trimethyl oct-7-enyl silicate?
trimethyl oct-7-enyl silicate has a molecular weight of 248.39 g/mol, XLogP of 2.51, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl oct-7-enyl silicate is sourced from PubChem (CID 154097389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).