About 1-diazo-1-ethoxyethane
1-diazo-1-ethoxyethane (PubChem CID 154099379) has the molecular formula C4H8N2O
and a molecular weight of 100.12 g/mol. Its IUPAC name is 1-diazo-1-ethoxyethane.
Molecular Properties
| Compound Name | 1-diazo-1-ethoxyethane |
| PubChem CID | 154099379 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | 1-diazo-1-ethoxyethane |
| SMILES | CCOC(C)=[N+]=[N-] |
| InChI | InChI=1S/C4H8N2O/c1-3-7-4(2)6-5/h3H2,1-2H3 |
| InChIKey | MEPWMCNYKBTVTI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 45.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-diazo-1-ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazo-1-ethoxyethane?
The IUPAC name of 1-diazo-1-ethoxyethane (CID 154099379) is 1-diazo-1-ethoxyethane.
What is the SMILES notation for 1-diazo-1-ethoxyethane?
The canonical SMILES for 1-diazo-1-ethoxyethane is CCOC(C)=[N+]=[N-].
What is the InChIKey of 1-diazo-1-ethoxyethane?
The InChIKey is MEPWMCNYKBTVTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O/c1-3-7-4(2)6-5/h3H2,1-2H3.
What are the key properties of 1-diazo-1-ethoxyethane?
1-diazo-1-ethoxyethane has a molecular weight of 100.12 g/mol, XLogP of 0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazo-1-ethoxyethane is sourced from PubChem (CID 154099379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).