About 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine
5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine (PubChem CID 154099520) has the molecular formula C16H12F3NS
and a molecular weight of 307.34 g/mol. Its IUPAC name is 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine.
Molecular Properties
| Compound Name | 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine |
| PubChem CID | 154099520 |
| Molecular Formula | C16H12F3NS |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine |
| SMILES | FC(F)(F)c1ccc2c(c1)C(c1ccccc1)=NCCS2 |
| InChI | InChI=1S/C16H12F3NS/c17-16(18,19)12-6-7-14-13(10-12)15(20-8-9-21-14)11-4-2-1-3-5-11/h1-7,10H,8-9H2 |
| InChIKey | JVOTYNTXFDAYPZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine?
The IUPAC name of 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine (CID 154099520) is 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine.
What is the SMILES notation for 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine?
The canonical SMILES for 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine is FC(F)(F)c1ccc2c(c1)C(c1ccccc1)=NCCS2.
What is the InChIKey of 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine?
The InChIKey is JVOTYNTXFDAYPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F3NS/c17-16(18,19)12-6-7-14-13(10-12)15(20-8-9-21-14)11-4-2-1-3-5-11/h1-7,10H,8-9H2.
What are the key properties of 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine?
5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine has a molecular weight of 307.34 g/mol, XLogP of 4.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-7-(trifluoromethyl)-2,3-dihydro-1,4-benzothiazepine is sourced from PubChem (CID 154099520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).