About 5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile
5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile (PubChem CID 154099953) has the molecular formula C15H11NOS
and a molecular weight of 253.33 g/mol. Its IUPAC name is 5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile.
Molecular Properties
| Compound Name | 5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile |
| PubChem CID | 154099953 |
| Molecular Formula | C15H11NOS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C(O)Cc1ccccc1S2 |
| InChI | InChI=1S/C15H11NOS/c16-9-10-5-6-15-12(7-10)13(17)8-11-3-1-2-4-14(11)18-15/h1-7,13,17H,8H2 |
| InChIKey | RQCDHJOUXOSKTM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile?
The IUPAC name of 5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile (CID 154099953) is 5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile.
What is the SMILES notation for 5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile?
The canonical SMILES for 5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile is N#Cc1ccc2c(c1)C(O)Cc1ccccc1S2.
What is the InChIKey of 5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile?
The InChIKey is RQCDHJOUXOSKTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NOS/c16-9-10-5-6-15-12(7-10)13(17)8-11-3-1-2-4-14(11)18-15/h1-7,13,17H,8H2.
What are the key properties of 5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile?
5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile has a molecular weight of 253.33 g/mol, XLogP of 3.30, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepine-3-carbonitrile is sourced from PubChem (CID 154099953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).