About hex-2-enylthiourea
hex-2-enylthiourea (PubChem CID 154101068) has the molecular formula C7H14N2S
and a molecular weight of 158.27 g/mol. Its IUPAC name is hex-2-enylthiourea.
Molecular Properties
| Compound Name | hex-2-enylthiourea |
| PubChem CID | 154101068 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | hex-2-enylthiourea |
| SMILES | CCCC=CCNC(N)=S |
| InChI | InChI=1S/C7H14N2S/c1-2-3-4-5-6-9-7(8)10/h4-5H,2-3,6H2,1H3,(H3,8,9,10) |
| InChIKey | SZOVREHVKQSZRH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze hex-2-enylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-2-enylthiourea?
The IUPAC name of hex-2-enylthiourea (CID 154101068) is hex-2-enylthiourea.
What is the SMILES notation for hex-2-enylthiourea?
The canonical SMILES for hex-2-enylthiourea is CCCC=CCNC(N)=S.
What is the InChIKey of hex-2-enylthiourea?
The InChIKey is SZOVREHVKQSZRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2S/c1-2-3-4-5-6-9-7(8)10/h4-5H,2-3,6H2,1H3,(H3,8,9,10).
What are the key properties of hex-2-enylthiourea?
hex-2-enylthiourea has a molecular weight of 158.27 g/mol, XLogP of 1.18, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hex-2-enylthiourea is sourced from PubChem (CID 154101068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).