About hydroxy(penta-1,4-dien-3-yl)silane
hydroxy(penta-1,4-dien-3-yl)silane (PubChem CID 154101073) has the molecular formula C5H10OSi
and a molecular weight of 114.22 g/mol. Its IUPAC name is hydroxy(penta-1,4-dien-3-yl)silane.
Molecular Properties
| Compound Name | hydroxy(penta-1,4-dien-3-yl)silane |
| PubChem CID | 154101073 |
| Molecular Formula | C5H10OSi |
| Molecular Weight | 114.22 g/mol |
| Exact Mass | 114.05 |
| IUPAC Name | hydroxy(penta-1,4-dien-3-yl)silane |
| SMILES | C=CC(C=C)[SiH2]O |
| InChI | InChI=1S/C5H10OSi/c1-3-5(4-2)7-6/h3-6H,1-2,7H2 |
| InChIKey | AIVBTEVJRNATTL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hydroxy(penta-1,4-dien-3-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy(penta-1,4-dien-3-yl)silane?
The IUPAC name of hydroxy(penta-1,4-dien-3-yl)silane (CID 154101073) is hydroxy(penta-1,4-dien-3-yl)silane.
What is the SMILES notation for hydroxy(penta-1,4-dien-3-yl)silane?
The canonical SMILES for hydroxy(penta-1,4-dien-3-yl)silane is C=CC(C=C)[SiH2]O.
What is the InChIKey of hydroxy(penta-1,4-dien-3-yl)silane?
The InChIKey is AIVBTEVJRNATTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10OSi/c1-3-5(4-2)7-6/h3-6H,1-2,7H2.
What are the key properties of hydroxy(penta-1,4-dien-3-yl)silane?
hydroxy(penta-1,4-dien-3-yl)silane has a molecular weight of 114.22 g/mol, XLogP of 0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy(penta-1,4-dien-3-yl)silane is sourced from PubChem (CID 154101073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).