About 2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane
2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane (PubChem CID 154101469) has the molecular formula C13H28O5Si
and a molecular weight of 292.45 g/mol. Its IUPAC name is 2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane.
Molecular Properties
| Compound Name | 2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane |
| PubChem CID | 154101469 |
| Molecular Formula | C13H28O5Si |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane |
| SMILES | C=COC(C)C(OCC)(OCC)OCCOCC[SiH3] |
| InChI | InChI=1S/C13H28O5Si/c1-5-15-12(4)13(16-6-2,17-7-3)18-9-8-14-10-11-19/h5,12H,1,6-11H2,2-4,19H3 |
| InChIKey | HGNQUUCYSUSBPQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane?
The IUPAC name of 2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane (CID 154101469) is 2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane.
What is the SMILES notation for 2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane?
The canonical SMILES for 2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane is C=COC(C)C(OCC)(OCC)OCCOCC[SiH3].
What is the InChIKey of 2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane?
The InChIKey is HGNQUUCYSUSBPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O5Si/c1-5-15-12(4)13(16-6-2,17-7-3)18-9-8-14-10-11-19/h5,12H,1,6-11H2,2-4,19H3.
What are the key properties of 2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane?
2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane has a molecular weight of 292.45 g/mol, XLogP of 1.08, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-ethenoxy-1,1-diethoxypropoxy)ethoxy]ethylsilane is sourced from PubChem (CID 154101469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).