C15H28O2 — CID 154101679
2-(2,2-diethoxyethylidene)-1,1,3-trimethylcyclohexane (PubChem CID 154101679) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-(2,2-diethoxyethylidene)-1,1,3-trimethylcyclohexane.
| Compound Name | 2-(2,2-diethoxyethylidene)-1,1,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 154101679 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 2-(2,2-diethoxyethylidene)-1,1,3-trimethylcyclohexane |
| SMILES | CCOC(C=C1C(C)CCCC1(C)C)OCC |
| InChI | InChI=1S/C15H28O2/c1-6-16-14(17-7-2)11-13-12(3)9-8-10-15(13,4)5/h11-12,14H,6-10H2,1-5H3 |
| InChIKey | ANMBOWSEZQSWQX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|