C42H58O6 — CID 154101929
3-(3,7-dimethylocta-2,6-dienyl)-5-[5-(3,7-dimethylocta-2,6-dienyl)-6-hydroxy-3,4-dioxo-2-pentylcyclohexa-1,5-dien-1-yl]-4-hydroxy-6-pentylcyclohexa-3,5-diene-1,2-dione (PubChem CID 154101929) has the molecular formula C42H58O6 and a molecular weight of 658.92 g/mol. Its IUPAC name is 3-(3,7-dimethylocta-2,6-dienyl)-5-[5-(3,7-dimethylocta-2,6-dienyl)-6-hydroxy-3,4-dioxo-2-pentylcyclohexa-1,5-dien-1-yl]-4-hydroxy-6-pentylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3-(3,7-dimethylocta-2,6-dienyl)-5-[5-(3,7-dimethylocta-2,6-dienyl)-6-hydroxy-3,4-dioxo-2-pentylcyclohexa-1,5-dien-1-yl]-4-hydroxy-6-pentylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 154101929 |
| Molecular Formula | C42H58O6 |
| Molecular Weight | 658.92 g/mol |
| Exact Mass | 658.42 |
| IUPAC Name | 3-(3,7-dimethylocta-2,6-dienyl)-5-[5-(3,7-dimethylocta-2,6-dienyl)-6-hydroxy-3,4-dioxo-2-pentylcyclohexa-1,5-dien-1-yl]-4-hydroxy-6-pentylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CCCCCC1=C(C2=C(CCCCC)C(=O)C(=O)C(CC=C(C)CCC=C(C)C)=C2O)C(O)=C(CC=C(C)CCC=C(C)C)C(=O)C1=O |
| InChI | InChI=1S/C42H58O6/c1-9-11-13-21-31-35(37(43)33(41(47)39(31)45)25-23-29(7)19-15-17-27(3)4)36-32(22-14-12-10-2)40(46)42(48)34(38(36)44)26-24-30(8)20-16-18-28(5)6/h17-18,23-24,43-44H,9-16,19-22,25-26H2,1-8H3 |
| InChIKey | GOTJGWICPYCWOZ-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.92 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|