C11H15F9Si — CID 154103595
[1,1,1,8,8,8-hexafluoro-5-(3,3,3-trifluoropropyl)oct-4-en-4-yl]silane (PubChem CID 154103595) has the molecular formula C11H15F9Si and a molecular weight of 346.31 g/mol. Its IUPAC name is [1,1,1,8,8,8-hexafluoro-5-(3,3,3-trifluoropropyl)oct-4-en-4-yl]silane.
| Compound Name | [1,1,1,8,8,8-hexafluoro-5-(3,3,3-trifluoropropyl)oct-4-en-4-yl]silane |
|---|---|
| PubChem CID | 154103595 |
| Molecular Formula | C11H15F9Si |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | [1,1,1,8,8,8-hexafluoro-5-(3,3,3-trifluoropropyl)oct-4-en-4-yl]silane |
| SMILES | FC(F)(F)CCC([SiH3])=C(CCC(F)(F)F)CCC(F)(F)F |
| InChI | InChI=1S/C11H15F9Si/c12-9(13,14)4-1-7(2-5-10(15,16)17)8(21)3-6-11(18,19)20/h1-6H2,21H3 |
| InChIKey | MSOAADVJZCTYMI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|