About N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine
N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine (PubChem CID 154104219) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine |
| PubChem CID | 154104219 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine |
| SMILES | COc1cc(OC)c2[nH]ccc2c1C=NO |
| InChI | InChI=1S/C11H12N2O3/c1-15-9-5-10(16-2)11-7(3-4-12-11)8(9)6-13-14/h3-6,12,14H,1-2H3 |
| InChIKey | FDILOJUELBLMJA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine?
The IUPAC name of N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine (CID 154104219) is N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine.
What is the SMILES notation for N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine?
The canonical SMILES for N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine is COc1cc(OC)c2[nH]ccc2c1C=NO.
What is the InChIKey of N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine?
The InChIKey is FDILOJUELBLMJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c1-15-9-5-10(16-2)11-7(3-4-12-11)8(9)6-13-14/h3-6,12,14H,1-2H3.
What are the key properties of N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine?
N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine has a molecular weight of 220.23 g/mol, XLogP of 1.99, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5,7-dimethoxy-1H-indol-4-yl)methylidene]hydroxylamine is sourced from PubChem (CID 154104219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).