About ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione
ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione (PubChem CID 154104535) has the molecular formula C7H9F3S3
and a molecular weight of 246.34 g/mol. Its IUPAC name is ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione.
Molecular Properties
| Compound Name | ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione |
| PubChem CID | 154104535 |
| Molecular Formula | C7H9F3S3 |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione |
| SMILES | CCSC(=S)SCCC(F)=C(F)F |
| InChI | InChI=1S/C7H9F3S3/c1-2-12-7(11)13-4-3-5(8)6(9)10/h2-4H2,1H3 |
| InChIKey | XLKUJXYLYBJQBV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione?
The IUPAC name of ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione (CID 154104535) is ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione.
What is the SMILES notation for ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione?
The canonical SMILES for ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione is CCSC(=S)SCCC(F)=C(F)F.
What is the InChIKey of ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione?
The InChIKey is XLKUJXYLYBJQBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3S3/c1-2-12-7(11)13-4-3-5(8)6(9)10/h2-4H2,1H3.
What are the key properties of ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione?
ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione has a molecular weight of 246.34 g/mol, XLogP of 4.23, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethylsulfanyl(3,4,4-trifluorobut-3-enylsulfanyl)methanethione is sourced from PubChem (CID 154104535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).