C7H4F5NO2 — CID 154104993
N-[(2,3,4,5,6-pentafluorophenyl)methoxy]hydroxylamine (PubChem CID 154104993) has the molecular formula C7H4F5NO2 and a molecular weight of 229.10 g/mol. Its IUPAC name is N-[(2,3,4,5,6-pentafluorophenyl)methoxy]hydroxylamine.
| Compound Name | N-[(2,3,4,5,6-pentafluorophenyl)methoxy]hydroxylamine |
|---|---|
| PubChem CID | 154104993 |
| Molecular Formula | C7H4F5NO2 |
| Molecular Weight | 229.10 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | N-[(2,3,4,5,6-pentafluorophenyl)methoxy]hydroxylamine |
| SMILES | ONOCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7H4F5NO2/c8-3-2(1-15-13-14)4(9)6(11)7(12)5(3)10/h13-14H,1H2 |
| InChIKey | LEVSHKKOVHKPIL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.10 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|