C4H8O7P2 — CID 154107161
2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 154107161) has the molecular formula C4H8O7P2 and a molecular weight of 230.05 g/mol. Its IUPAC name is 2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | 2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 154107161 |
| Molecular Formula | C4H8O7P2 |
| Molecular Weight | 230.05 g/mol |
| Exact Mass | 229.97 |
| IUPAC Name | 2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | O=P1(OP2(=O)OCCO2)OCCO1 |
| InChI | InChI=1S/C4H8O7P2/c5-12(7-1-2-8-12)11-13(6)9-3-4-10-13/h1-4H2 |
| InChIKey | ZOVYWRWMCPJRQA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.05 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|