C17H22N2 — CID 154107703
(4aR,8aR)-1-methyl-6-phenyl-2,3,4,4a,5,7,8,8a-octahydroquinoline-6-carbonitrile (PubChem CID 154107703) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (4aR,8aR)-1-methyl-6-phenyl-2,3,4,4a,5,7,8,8a-octahydroquinoline-6-carbonitrile.
| Compound Name | (4aR,8aR)-1-methyl-6-phenyl-2,3,4,4a,5,7,8,8a-octahydroquinoline-6-carbonitrile |
|---|---|
| PubChem CID | 154107703 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (4aR,8aR)-1-methyl-6-phenyl-2,3,4,4a,5,7,8,8a-octahydroquinoline-6-carbonitrile |
| SMILES | CN1CCC[C@@H]2CC(C#N)(c3ccccc3)CC[C@H]21 |
| InChI | InChI=1S/C17H22N2/c1-19-11-5-6-14-12-17(13-18,10-9-16(14)19)15-7-3-2-4-8-15/h2-4,7-8,14,16H,5-6,9-12H2,1H3/t14-,16-,17?/m1/s1 |
| InChIKey | YDSWEWAVXWENSQ-IYNBXCLQSA-N |
| XLogP | 3.34 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |