C7H14N5O2PS2 — CID 154108072
6-(dimethoxyphosphinothioylsulfanylmethyl)-2-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 154108072) has the molecular formula C7H14N5O2PS2 and a molecular weight of 295.33 g/mol. Its IUPAC name is 6-(dimethoxyphosphinothioylsulfanylmethyl)-2-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(dimethoxyphosphinothioylsulfanylmethyl)-2-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 154108072 |
| Molecular Formula | C7H14N5O2PS2 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 6-(dimethoxyphosphinothioylsulfanylmethyl)-2-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N)nc(CSP(=S)(OC)OC)n1 |
| InChI | InChI=1S/C7H14N5O2PS2/c1-9-7-11-5(10-6(8)12-7)4-17-15(16,13-2)14-3/h4H2,1-3H3,(H3,8,9,10,11,12) |
| InChIKey | OXHZKEGGGSYZNV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|