About 5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one
5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one (PubChem CID 154109824) has the molecular formula C10H16O3S
and a molecular weight of 216.30 g/mol. Its IUPAC name is 5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one.
Molecular Properties
| Compound Name | 5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one |
| PubChem CID | 154109824 |
| Molecular Formula | C10H16O3S |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one |
| SMILES | CC(C)=CC1C(C)CC(=O)CS1(=O)=O |
| InChI | InChI=1S/C10H16O3S/c1-7(2)4-10-8(3)5-9(11)6-14(10,12)13/h4,8,10H,5-6H2,1-3H3 |
| InChIKey | WOHBBEZHJXGXMQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one?
The IUPAC name of 5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one (CID 154109824) is 5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one.
What is the SMILES notation for 5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one?
The canonical SMILES for 5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one is CC(C)=CC1C(C)CC(=O)CS1(=O)=O.
What is the InChIKey of 5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one?
The InChIKey is WOHBBEZHJXGXMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3S/c1-7(2)4-10-8(3)5-9(11)6-14(10,12)13/h4,8,10H,5-6H2,1-3H3.
What are the key properties of 5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one?
5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one has a molecular weight of 216.30 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-(2-methylprop-1-enyl)-1,1-dioxothian-3-one is sourced from PubChem (CID 154109824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).