About 3H-imidazo[1,2-a]pyridin-2-ylidenemethanone
3H-imidazo[1,2-a]pyridin-2-ylidenemethanone (PubChem CID 154109914) has the molecular formula C8H6N2O
and a molecular weight of 146.15 g/mol. Its IUPAC name is 3H-imidazo[1,2-a]pyridin-2-ylidenemethanone.
Molecular Properties
| Compound Name | 3H-imidazo[1,2-a]pyridin-2-ylidenemethanone |
| PubChem CID | 154109914 |
| Molecular Formula | C8H6N2O |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 3H-imidazo[1,2-a]pyridin-2-ylidenemethanone |
| SMILES | O=C=C1CN2C=CC=CC2=N1 |
| InChI | InChI=1S/C8H6N2O/c11-6-7-5-10-4-2-1-3-8(10)9-7/h1-4H,5H2 |
| InChIKey | HLDHHJRSTIHUIJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 3H-imidazo[1,2-a]pyridin-2-ylidenemethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-imidazo[1,2-a]pyridin-2-ylidenemethanone?
The IUPAC name of 3H-imidazo[1,2-a]pyridin-2-ylidenemethanone (CID 154109914) is 3H-imidazo[1,2-a]pyridin-2-ylidenemethanone.
What is the SMILES notation for 3H-imidazo[1,2-a]pyridin-2-ylidenemethanone?
The canonical SMILES for 3H-imidazo[1,2-a]pyridin-2-ylidenemethanone is O=C=C1CN2C=CC=CC2=N1.
What is the InChIKey of 3H-imidazo[1,2-a]pyridin-2-ylidenemethanone?
The InChIKey is HLDHHJRSTIHUIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O/c11-6-7-5-10-4-2-1-3-8(10)9-7/h1-4H,5H2.
What are the key properties of 3H-imidazo[1,2-a]pyridin-2-ylidenemethanone?
3H-imidazo[1,2-a]pyridin-2-ylidenemethanone has a molecular weight of 146.15 g/mol, XLogP of 0.50, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-imidazo[1,2-a]pyridin-2-ylidenemethanone is sourced from PubChem (CID 154109914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).