About 5,6-dichloro-1,3-benzodioxole-2-thione
5,6-dichloro-1,3-benzodioxole-2-thione (PubChem CID 154109938) has the molecular formula C7H2Cl2O2S
and a molecular weight of 221.06 g/mol. Its IUPAC name is 5,6-dichloro-1,3-benzodioxole-2-thione.
Molecular Properties
| Compound Name | 5,6-dichloro-1,3-benzodioxole-2-thione |
| PubChem CID | 154109938 |
| Molecular Formula | C7H2Cl2O2S |
| Molecular Weight | 221.06 g/mol |
| Exact Mass | 219.92 |
| IUPAC Name | 5,6-dichloro-1,3-benzodioxole-2-thione |
| SMILES | S=c1oc2cc(Cl)c(Cl)cc2o1 |
| InChI | InChI=1S/C7H2Cl2O2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H |
| InChIKey | FXLMBHMILGHGPK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.06 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichloro-1,3-benzodioxole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-1,3-benzodioxole-2-thione?
The IUPAC name of 5,6-dichloro-1,3-benzodioxole-2-thione (CID 154109938) is 5,6-dichloro-1,3-benzodioxole-2-thione.
What is the SMILES notation for 5,6-dichloro-1,3-benzodioxole-2-thione?
The canonical SMILES for 5,6-dichloro-1,3-benzodioxole-2-thione is S=c1oc2cc(Cl)c(Cl)cc2o1.
What is the InChIKey of 5,6-dichloro-1,3-benzodioxole-2-thione?
The InChIKey is FXLMBHMILGHGPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2Cl2O2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H.
What are the key properties of 5,6-dichloro-1,3-benzodioxole-2-thione?
5,6-dichloro-1,3-benzodioxole-2-thione has a molecular weight of 221.06 g/mol, XLogP of 4.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-1,3-benzodioxole-2-thione is sourced from PubChem (CID 154109938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).