C6H17N3Si3 — CID 154109962
1,2-bis(ethenyl)-3,5-dimethyl-1,3,5,2,4,6-triazatrisilinane (PubChem CID 154109962) has the molecular formula C6H17N3Si3 and a molecular weight of 215.48 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-3,5-dimethyl-1,3,5,2,4,6-triazatrisilinane.
| Compound Name | 1,2-bis(ethenyl)-3,5-dimethyl-1,3,5,2,4,6-triazatrisilinane |
|---|---|
| PubChem CID | 154109962 |
| Molecular Formula | C6H17N3Si3 |
| Molecular Weight | 215.48 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1,2-bis(ethenyl)-3,5-dimethyl-1,3,5,2,4,6-triazatrisilinane |
| SMILES | C=CN1[SiH2]N(C)[SiH2]N(C)[SiH]1C=C |
| InChI | InChI=1S/C6H17N3Si3/c1-5-9-11-7(3)10-8(4)12(9)6-2/h5-6,12H,1-2,10-11H2,3-4H3 |
| InChIKey | YZYSVGCKUIBVTG-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.48 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|