C12H16N2O6 — CID 154111425
(2R)-2-[(2-ethoxy-5-oxo-2H-furan-3-yl)carbamoyl]pyrrolidine-1-carboxylic acid (PubChem CID 154111425) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is (2R)-2-[(2-ethoxy-5-oxo-2H-furan-3-yl)carbamoyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2R)-2-[(2-ethoxy-5-oxo-2H-furan-3-yl)carbamoyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154111425 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (2R)-2-[(2-ethoxy-5-oxo-2H-furan-3-yl)carbamoyl]pyrrolidine-1-carboxylic acid |
| SMILES | CCOC1OC(=O)C=C1NC(=O)[C@H]1CCCN1C(=O)O |
| InChI | InChI=1S/C12H16N2O6/c1-2-19-11-7(6-9(15)20-11)13-10(16)8-4-3-5-14(8)12(17)18/h6,8,11H,2-5H2,1H3,(H,13,16)(H,17,18)/t8-,11?/m1/s1 |
| InChIKey | YHGYMGLHCCXMDF-RZZZFEHKSA-N |
| XLogP | 0.05 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |