C15H37NO6Si2 — CID 154111466
1,3-bis(triethoxysilyl)propan-1-amine (PubChem CID 154111466) has the molecular formula C15H37NO6Si2 and a molecular weight of 383.63 g/mol. Its IUPAC name is 1,3-bis(triethoxysilyl)propan-1-amine.
| Compound Name | 1,3-bis(triethoxysilyl)propan-1-amine |
|---|---|
| PubChem CID | 154111466 |
| Molecular Formula | C15H37NO6Si2 |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 1,3-bis(triethoxysilyl)propan-1-amine |
| SMILES | CCO[Si](CCC(N)[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C15H37NO6Si2/c1-7-17-23(18-8-2,19-9-3)14-13-15(16)24(20-10-4,21-11-5)22-12-6/h15H,7-14,16H2,1-6H3 |
| InChIKey | AWIDONDHFQSSNA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|