C13H24N6O — CID 154111602
N-[4,6-bis(diethylamino)-1,3,5-triazin-2-yl]acetamide (PubChem CID 154111602) has the molecular formula C13H24N6O and a molecular weight of 280.38 g/mol. Its IUPAC name is N-[4,6-bis(diethylamino)-1,3,5-triazin-2-yl]acetamide.
| Compound Name | N-[4,6-bis(diethylamino)-1,3,5-triazin-2-yl]acetamide |
|---|---|
| PubChem CID | 154111602 |
| Molecular Formula | C13H24N6O |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | N-[4,6-bis(diethylamino)-1,3,5-triazin-2-yl]acetamide |
| SMILES | CCN(CC)c1nc(NC(C)=O)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C13H24N6O/c1-6-18(7-2)12-15-11(14-10(5)20)16-13(17-12)19(8-3)9-4/h6-9H2,1-5H3,(H,14,15,16,17,20) |
| InChIKey | SYCQFYSFBWDDMH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |