C10H2F5NO2 — CID 154111698
3-(4-cyano-2,3,5,6-tetrafluorophenyl)-2-fluoroprop-2-enoic acid (PubChem CID 154111698) has the molecular formula C10H2F5NO2 and a molecular weight of 263.12 g/mol. Its IUPAC name is 3-(4-cyano-2,3,5,6-tetrafluorophenyl)-2-fluoroprop-2-enoic acid.
| Compound Name | 3-(4-cyano-2,3,5,6-tetrafluorophenyl)-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 154111698 |
| Molecular Formula | C10H2F5NO2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 3-(4-cyano-2,3,5,6-tetrafluorophenyl)-2-fluoroprop-2-enoic acid |
| SMILES | N#Cc1c(F)c(F)c(C=C(F)C(=O)O)c(F)c1F |
| InChI | InChI=1S/C10H2F5NO2/c11-5(10(17)18)1-3-6(12)8(14)4(2-16)9(15)7(3)13/h1H,(H,17,18) |
| InChIKey | BYNSDYDKJBPSGU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|