C7H8N6 — CID 154111959
2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine (PubChem CID 154111959) has the molecular formula C7H8N6 and a molecular weight of 176.18 g/mol. Its IUPAC name is 2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine.
| Compound Name | 2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine |
|---|---|
| PubChem CID | 154111959 |
| Molecular Formula | C7H8N6 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine |
| SMILES | Nc1nc2c3c([nH]nc3n1)CCN2 |
| InChI | InChI=1S/C7H8N6/c8-7-10-5-4-3(1-2-9-5)12-13-6(4)11-7/h1-2H2,(H4,8,9,10,11,12,13) |
| InChIKey | GIQLTYMXOGIPNY-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |