About N'-(2,3-dimethylphenyl)-N-phenylmethanediimine
N'-(2,3-dimethylphenyl)-N-phenylmethanediimine (PubChem CID 154114058) has the molecular formula C15H14N2
and a molecular weight of 222.29 g/mol. Its IUPAC name is N'-(2,3-dimethylphenyl)-N-phenylmethanediimine.
Molecular Properties
| Compound Name | N'-(2,3-dimethylphenyl)-N-phenylmethanediimine |
| PubChem CID | 154114058 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N'-(2,3-dimethylphenyl)-N-phenylmethanediimine |
| SMILES | Cc1cccc(N=C=Nc2ccccc2)c1C |
| InChI | InChI=1S/C15H14N2/c1-12-7-6-10-15(13(12)2)17-11-16-14-8-4-3-5-9-14/h3-10H,1-2H3 |
| InChIKey | LUKMYCPRWYXTGI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,3-dimethylphenyl)-N-phenylmethanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,3-dimethylphenyl)-N-phenylmethanediimine?
The IUPAC name of N'-(2,3-dimethylphenyl)-N-phenylmethanediimine (CID 154114058) is N'-(2,3-dimethylphenyl)-N-phenylmethanediimine.
What is the SMILES notation for N'-(2,3-dimethylphenyl)-N-phenylmethanediimine?
The canonical SMILES for N'-(2,3-dimethylphenyl)-N-phenylmethanediimine is Cc1cccc(N=C=Nc2ccccc2)c1C.
What is the InChIKey of N'-(2,3-dimethylphenyl)-N-phenylmethanediimine?
The InChIKey is LUKMYCPRWYXTGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2/c1-12-7-6-10-15(13(12)2)17-11-16-14-8-4-3-5-9-14/h3-10H,1-2H3.
What are the key properties of N'-(2,3-dimethylphenyl)-N-phenylmethanediimine?
N'-(2,3-dimethylphenyl)-N-phenylmethanediimine has a molecular weight of 222.29 g/mol, XLogP of 4.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,3-dimethylphenyl)-N-phenylmethanediimine is sourced from PubChem (CID 154114058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).