C20H23N3O3S — CID 154114456
N-[4-(benzimidazole-1-carbonyl)phenyl]hexane-1-sulfonamide (PubChem CID 154114456) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-[4-(benzimidazole-1-carbonyl)phenyl]hexane-1-sulfonamide.
| Compound Name | N-[4-(benzimidazole-1-carbonyl)phenyl]hexane-1-sulfonamide |
|---|---|
| PubChem CID | 154114456 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-[4-(benzimidazole-1-carbonyl)phenyl]hexane-1-sulfonamide |
| SMILES | CCCCCCS(=O)(=O)Nc1ccc(C(=O)n2cnc3ccccc32)cc1 |
| InChI | InChI=1S/C20H23N3O3S/c1-2-3-4-7-14-27(25,26)22-17-12-10-16(11-13-17)20(24)23-15-21-18-8-5-6-9-19(18)23/h5-6,8-13,15,22H,2-4,7,14H2,1H3 |
| InChIKey | WOFKWNKBEVFQGS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|