C15H26 — CID 154116674
1,2,2,3,4-pentamethyladamantane (PubChem CID 154116674) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 1,2,2,3,4-pentamethyladamantane.
| Compound Name | 1,2,2,3,4-pentamethyladamantane |
|---|---|
| PubChem CID | 154116674 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 1,2,2,3,4-pentamethyladamantane |
| SMILES | CC1C2CC3CC(C)(C2)C(C)(C)C1(C)C3 |
| InChI | InChI=1S/C15H26/c1-10-12-6-11-7-14(4,9-12)13(2,3)15(10,5)8-11/h10-12H,6-9H2,1-5H3 |
| InChIKey | OLKBIJWONUIVEC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |