C12H24N2O2 — CID 154116684
N-(5-acetamido-2,5-dimethylhexan-2-yl)acetamide (PubChem CID 154116684) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-(5-acetamido-2,5-dimethylhexan-2-yl)acetamide.
| Compound Name | N-(5-acetamido-2,5-dimethylhexan-2-yl)acetamide |
|---|---|
| PubChem CID | 154116684 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N-(5-acetamido-2,5-dimethylhexan-2-yl)acetamide |
| SMILES | CC(=O)NC(C)(C)CCC(C)(C)NC(C)=O |
| InChI | InChI=1S/C12H24N2O2/c1-9(15)13-11(3,4)7-8-12(5,6)14-10(2)16/h7-8H2,1-6H3,(H,13,15)(H,14,16) |
| InChIKey | BKJOQWNAMRHWEK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |