C41H78O4Si2 — CID 15411808
1,3-bis[tri(propan-2-yl)silyloxy]propan-2-yl (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate (PubChem CID 15411808) has the molecular formula C41H78O4Si2 and a molecular weight of 691.24 g/mol. Its IUPAC name is 1,3-bis[tri(propan-2-yl)silyloxy]propan-2-yl (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate.
| Compound Name | 1,3-bis[tri(propan-2-yl)silyloxy]propan-2-yl (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 15411808 |
| Molecular Formula | C41H78O4Si2 |
| Molecular Weight | 691.24 g/mol |
| Exact Mass | 690.54 |
| IUPAC Name | 1,3-bis[tri(propan-2-yl)silyloxy]propan-2-yl (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)OC(CO[Si](C(C)C)(C(C)C)C(C)C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C41H78O4Si2/c1-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-31-41(42)45-40(32-43-46(34(2)3,35(4)5)36(6)7)33-44-47(37(8)9,38(10)11)39(12)13/h18-19,21-22,24-25,27-28,34-40H,14-17,20,23,26,29-33H2,1-13H3/b19-18+,22-21+,25-24+,28-27+ |
| InChIKey | KDMVHNWBBNDCOH-IMRWMJGBSA-N |
| XLogP | 13.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.24 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|